C36H31N3O2 — CID 177144976
3,3,4,4-tetramethyl-1-[4-(3-phenylphenyl)-6-(4-phenylphenyl)pyrimidin-2-yl]pyrrolidine-2,5-dione (PubChem CID 177144976) has the molecular formula C36H31N3O2 and a molecular weight of 537.66 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-1-[4-(3-phenylphenyl)-6-(4-phenylphenyl)pyrimidin-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 3,3,4,4-tetramethyl-1-[4-(3-phenylphenyl)-6-(4-phenylphenyl)pyrimidin-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 177144976 |
| Molecular Formula | C36H31N3O2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 3,3,4,4-tetramethyl-1-[4-(3-phenylphenyl)-6-(4-phenylphenyl)pyrimidin-2-yl]pyrrolidine-2,5-dione |
| SMILES | CC1(C)C(=O)N(c2nc(-c3ccc(-c4ccccc4)cc3)cc(-c3cccc(-c4ccccc4)c3)n2)C(=O)C1(C)C |
| InChI | InChI=1S/C36H31N3O2/c1-35(2)32(40)39(33(41)36(35,3)4)34-37-30(27-20-18-26(19-21-27)24-12-7-5-8-13-24)23-31(38-34)29-17-11-16-28(22-29)25-14-9-6-10-15-25/h5-23H,1-4H3 |
| InChIKey | KYHWYZOTHANDPY-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|