C42H32N4O2 — CID 177145055
3,3,4,4-tetramethyl-1-[4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazin-2-yl]pyrrolidine-2,5-dione (PubChem CID 177145055) has the molecular formula C42H32N4O2 and a molecular weight of 624.74 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-1-[4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazin-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 3,3,4,4-tetramethyl-1-[4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazin-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 177145055 |
| Molecular Formula | C42H32N4O2 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | 3,3,4,4-tetramethyl-1-[4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazin-2-yl]pyrrolidine-2,5-dione |
| SMILES | CC1(C)C(=O)N(c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3ccccc3-4)n2)C(=O)C1(C)C |
| InChI | InChI=1S/C42H32N4O2/c1-40(2)37(47)46(38(48)41(40,3)4)39-44-35(25-14-6-5-7-15-25)43-36(45-39)26-22-23-30-29-18-10-13-21-33(29)42(34(30)24-26)31-19-11-8-16-27(31)28-17-9-12-20-32(28)42/h5-24H,1-4H3 |
| InChIKey | SVOSGXGJKFWKTJ-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|