C17H14N2O3S — CID 22149443
1-benzyl-5-phenyl-5-sulfanyl-1,3-diazinane-2,4,6-trione (PubChem CID 22149443) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is 1-benzyl-5-phenyl-5-sulfanyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-benzyl-5-phenyl-5-sulfanyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 22149443 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1-benzyl-5-phenyl-5-sulfanyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(S)(c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H14N2O3S/c20-14-17(23,13-9-5-2-6-10-13)15(21)19(16(22)18-14)11-12-7-3-1-4-8-12/h1-10,23H,11H2,(H,18,20,22) |
| InChIKey | VWDIVHNAODKQCW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|