C17H19ClN2O4 — CID 19975168
5-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)pentanoyl chloride (PubChem CID 19975168) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is 5-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)pentanoyl chloride.
| Compound Name | 5-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)pentanoyl chloride |
|---|---|
| PubChem CID | 19975168 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 5-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)pentanoyl chloride |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)N(CCCCC(=O)Cl)C1=O |
| InChI | InChI=1S/C17H19ClN2O4/c1-2-17(12-8-4-3-5-9-12)14(22)19-16(24)20(15(17)23)11-7-6-10-13(18)21/h3-5,8-9H,2,6-7,10-11H2,1H3,(H,19,22,24) |
| InChIKey | KKUPBFNQTHGADL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|