C21H29N3O8 — CID 67884333
[1-butoxy-3-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)propan-2-yl] carbamate;formic acid (PubChem CID 67884333) has the molecular formula C21H29N3O8 and a molecular weight of 451.48 g/mol. Its IUPAC name is [1-butoxy-3-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)propan-2-yl] carbamate;formic acid.
| Compound Name | [1-butoxy-3-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)propan-2-yl] carbamate;formic acid |
|---|---|
| PubChem CID | 67884333 |
| Molecular Formula | C21H29N3O8 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | [1-butoxy-3-(5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)propan-2-yl] carbamate;formic acid |
| SMILES | CCCCOCC(CN1C(=O)NC(=O)C(CC)(c2ccccc2)C1=O)OC(N)=O.O=CO |
| InChI | InChI=1S/C20H27N3O6.CH2O2/c1-3-5-11-28-13-15(29-18(21)26)12-23-17(25)20(4-2,16(24)22-19(23)27)14-9-7-6-8-10-14;2-1-3/h6-10,15H,3-5,11-13H2,1-2H3,(H2,21,26)(H,22,24,27);1H,(H,2,3) |
| InChIKey | VRXCGDKSPZDLMV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 165.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|