C28H42N4O9 — CID 57394585
[1-butoxy-3-[3-(2-carbamoyloxy-2-pentoxyethyl)-5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl]propan-2-yl] carbamate (PubChem CID 57394585) has the molecular formula C28H42N4O9 and a molecular weight of 578.66 g/mol. Its IUPAC name is [1-butoxy-3-[3-(2-carbamoyloxy-2-pentoxyethyl)-5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl]propan-2-yl] carbamate.
| Compound Name | [1-butoxy-3-[3-(2-carbamoyloxy-2-pentoxyethyl)-5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl]propan-2-yl] carbamate |
|---|---|
| PubChem CID | 57394585 |
| Molecular Formula | C28H42N4O9 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | [1-butoxy-3-[3-(2-carbamoyloxy-2-pentoxyethyl)-5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl]propan-2-yl] carbamate |
| SMILES | CCCCCOC(CN1C(=O)N(CC(COCCCC)OC(N)=O)C(=O)C(CC)(c2ccccc2)C1=O)OC(N)=O |
| InChI | InChI=1S/C28H42N4O9/c1-4-7-12-16-39-22(41-26(30)36)18-32-24(34)28(6-3,20-13-10-9-11-14-20)23(33)31(27(32)37)17-21(40-25(29)35)19-38-15-8-5-2/h9-11,13-14,21-22H,4-8,12,15-19H2,1-3H3,(H2,29,35)(H2,30,36) |
| InChIKey | DXCDTAQKDOXTKV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 180.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|