About 1-butoxybutan-2-yl carbamate
1-butoxybutan-2-yl carbamate (PubChem CID 153396389) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is 1-butoxybutan-2-yl carbamate.
Molecular Properties
| Compound Name | 1-butoxybutan-2-yl carbamate |
| PubChem CID | 153396389 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 1-butoxybutan-2-yl carbamate |
| SMILES | CCCCOCC(CC)OC(N)=O |
| InChI | InChI=1S/C9H19NO3/c1-3-5-6-12-7-8(4-2)13-9(10)11/h8H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | PWSQNCQLJQNAQL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxybutan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxybutan-2-yl carbamate?
The IUPAC name of 1-butoxybutan-2-yl carbamate (CID 153396389) is 1-butoxybutan-2-yl carbamate.
What is the SMILES notation for 1-butoxybutan-2-yl carbamate?
The canonical SMILES for 1-butoxybutan-2-yl carbamate is CCCCOCC(CC)OC(N)=O.
What is the InChIKey of 1-butoxybutan-2-yl carbamate?
The InChIKey is PWSQNCQLJQNAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-3-5-6-12-7-8(4-2)13-9(10)11/h8H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of 1-butoxybutan-2-yl carbamate?
1-butoxybutan-2-yl carbamate has a molecular weight of 189.25 g/mol, XLogP of 1.68, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxybutan-2-yl carbamate is sourced from PubChem (CID 153396389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).