C15H16N2O5 — CID 14983740
(5-methyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)methyl propanoate (PubChem CID 14983740) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is (5-methyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)methyl propanoate.
| Compound Name | (5-methyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)methyl propanoate |
|---|---|
| PubChem CID | 14983740 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (5-methyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl)methyl propanoate |
| SMILES | CCC(=O)OCN1C(=O)NC(=O)C(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H16N2O5/c1-3-11(18)22-9-17-13(20)15(2,12(19)16-14(17)21)10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3,(H,16,19,21) |
| InChIKey | CSKRBIJTUFVBSD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|