C15H16N2O5 — CID 67864262
3-[(5R)-5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl]propanoic acid (PubChem CID 67864262) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 3-[(5R)-5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl]propanoic acid.
| Compound Name | 3-[(5R)-5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl]propanoic acid |
|---|---|
| PubChem CID | 67864262 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-[(5R)-5-ethyl-2,4,6-trioxo-5-phenyl-1,3-diazinan-1-yl]propanoic acid |
| SMILES | CC[C@@]1(c2ccccc2)C(=O)NC(=O)N(CCC(=O)O)C1=O |
| InChI | InChI=1S/C15H16N2O5/c1-2-15(10-6-4-3-5-7-10)12(20)16-14(22)17(13(15)21)9-8-11(18)19/h3-7H,2,8-9H2,1H3,(H,18,19)(H,16,20,22)/t15-/m1/s1 |
| InChIKey | BMOATIFCGFMOTI-OAHLLOKOSA-N |
| XLogP | 0.89 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|