C22H17NO3 — CID 10904013
3-benzyl-5,5-diphenyl-1,3-oxazolidine-2,4-dione (PubChem CID 10904013) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-benzyl-5,5-diphenyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-benzyl-5,5-diphenyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 10904013 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-benzyl-5,5-diphenyl-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H17NO3/c24-20-22(18-12-6-2-7-13-18,19-14-8-3-9-15-19)26-21(25)23(20)16-17-10-4-1-5-11-17/h1-15H,16H2 |
| InChIKey | YLNYYMQTVLJLJH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |