C28H23NO2 — CID 10763812
(4R)-3-benzyl-4,5,5-triphenyl-1,3-oxazolidin-2-one (PubChem CID 10763812) has the molecular formula C28H23NO2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (4R)-3-benzyl-4,5,5-triphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-benzyl-4,5,5-triphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10763812 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (4R)-3-benzyl-4,5,5-triphenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H23NO2/c30-27-29(21-22-13-5-1-6-14-22)26(23-15-7-2-8-16-23)28(31-27,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20,26H,21H2/t26-/m1/s1 |
| InChIKey | ONFVPSFXXUPSMV-AREMUKBSSA-N |
| XLogP | 6.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |