C17H15NO3 — CID 170762067
(4S)-3,4-dibenzyl-1,3-oxazolidine-2,5-dione (PubChem CID 170762067) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (4S)-3,4-dibenzyl-1,3-oxazolidine-2,5-dione.
| Compound Name | (4S)-3,4-dibenzyl-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 170762067 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (4S)-3,4-dibenzyl-1,3-oxazolidine-2,5-dione |
| SMILES | O=C1OC(=O)N(Cc2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H15NO3/c19-16-15(11-13-7-3-1-4-8-13)18(17(20)21-16)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2/t15-/m0/s1 |
| InChIKey | WVWQTANJFUGUAR-HNNXBMFYSA-N |
| XLogP | 2.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|