C18H16N2O4 — CID 88671759
(3aR,6aS)-1,3-dibenzyl-3a,6a-dihydrofuro[3,4-c][1,2,5]oxadiazole-4,6-dione (PubChem CID 88671759) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is (3aR,6aS)-1,3-dibenzyl-3a,6a-dihydrofuro[3,4-c][1,2,5]oxadiazole-4,6-dione.
| Compound Name | (3aR,6aS)-1,3-dibenzyl-3a,6a-dihydrofuro[3,4-c][1,2,5]oxadiazole-4,6-dione |
|---|---|
| PubChem CID | 88671759 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (3aR,6aS)-1,3-dibenzyl-3a,6a-dihydrofuro[3,4-c][1,2,5]oxadiazole-4,6-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1N(Cc1ccccc1)ON2Cc1ccccc1 |
| InChI | InChI=1S/C18H16N2O4/c21-17-15-16(18(22)23-17)20(12-14-9-5-2-6-10-14)24-19(15)11-13-7-3-1-4-8-13/h1-10,15-16H,11-12H2/t15-,16+ |
| InChIKey | JRXYYJWLRGLCTL-IYBDPMFKSA-N |
| XLogP | 1.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|