C11H13NO2 — CID 13358936
(3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one (PubChem CID 13358936) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one.
| Compound Name | (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 13358936 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one |
| SMILES | C[C@@H]1CC(=O)ON1Cc1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c1-9-7-11(13)14-12(9)8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | QNEJEOULQGPSBD-SECBINFHSA-N |
| XLogP | 1.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |