About (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one
(3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one (PubChem CID 13358936) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one.
Molecular Properties
| Compound Name | (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one |
| PubChem CID | 13358936 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one |
| SMILES | C[C@@H]1CC(=O)ON1Cc1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c1-9-7-11(13)14-12(9)8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | QNEJEOULQGPSBD-SECBINFHSA-N |
| XLogP | 1.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one?
The IUPAC name of (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one (CID 13358936) is (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one.
What is the SMILES notation for (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one?
The canonical SMILES for (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one is C[C@@H]1CC(=O)ON1Cc1ccccc1.
What is the InChIKey of (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one?
The InChIKey is QNEJEOULQGPSBD-SECBINFHSA-N. The full InChI is InChI=1S/C11H13NO2/c1-9-7-11(13)14-12(9)8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-/m1/s1.
What are the key properties of (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one?
(3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one has a molecular weight of 191.23 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-benzyl-3-methyl-1,2-oxazolidin-5-one is sourced from PubChem (CID 13358936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).