C14H17NO2 — CID 86714742
2-benzyl-3-cyclobutyl-1,2-oxazolidin-5-one (PubChem CID 86714742) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-benzyl-3-cyclobutyl-1,2-oxazolidin-5-one.
| Compound Name | 2-benzyl-3-cyclobutyl-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 86714742 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-benzyl-3-cyclobutyl-1,2-oxazolidin-5-one |
| SMILES | O=C1CC(C2CCC2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H17NO2/c16-14-9-13(12-7-4-8-12)15(17-14)10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2 |
| InChIKey | MINAQWQSFRFQFY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |