C12H14ClNO2 — CID 15839778
2-benzyl-3-(2-chloroethyl)-1,2-oxazolidin-5-one (PubChem CID 15839778) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 2-benzyl-3-(2-chloroethyl)-1,2-oxazolidin-5-one.
| Compound Name | 2-benzyl-3-(2-chloroethyl)-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 15839778 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-benzyl-3-(2-chloroethyl)-1,2-oxazolidin-5-one |
| SMILES | O=C1CC(CCCl)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C12H14ClNO2/c13-7-6-11-8-12(15)16-14(11)9-10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | MJXXAVXEDSUBEE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|