About (6R)-1,6-dibenzylpiperidine-2,4-dione
(6R)-1,6-dibenzylpiperidine-2,4-dione (PubChem CID 54253000) has the molecular formula C19H19NO2
and a molecular weight of 293.37 g/mol. Its IUPAC name is (6R)-1,6-dibenzylpiperidine-2,4-dione.
Molecular Properties
| Compound Name | (6R)-1,6-dibenzylpiperidine-2,4-dione |
| PubChem CID | 54253000 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (6R)-1,6-dibenzylpiperidine-2,4-dione |
| SMILES | O=C1CC(=O)N(Cc2ccccc2)[C@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H19NO2/c21-18-12-17(11-15-7-3-1-4-8-15)20(19(22)13-18)14-16-9-5-2-6-10-16/h1-10,17H,11-14H2/t17-/m1/s1 |
| InChIKey | QYBOPMXFDKZJSD-QGZVFWFLSA-N |
| XLogP | 2.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (6R)-1,6-dibenzylpiperidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-1,6-dibenzylpiperidine-2,4-dione?
The IUPAC name of (6R)-1,6-dibenzylpiperidine-2,4-dione (CID 54253000) is (6R)-1,6-dibenzylpiperidine-2,4-dione.
What is the SMILES notation for (6R)-1,6-dibenzylpiperidine-2,4-dione?
The canonical SMILES for (6R)-1,6-dibenzylpiperidine-2,4-dione is O=C1CC(=O)N(Cc2ccccc2)[C@H](Cc2ccccc2)C1.
What is the InChIKey of (6R)-1,6-dibenzylpiperidine-2,4-dione?
The InChIKey is QYBOPMXFDKZJSD-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H19NO2/c21-18-12-17(11-15-7-3-1-4-8-15)20(19(22)13-18)14-16-9-5-2-6-10-16/h1-10,17H,11-14H2/t17-/m1/s1.
What are the key properties of (6R)-1,6-dibenzylpiperidine-2,4-dione?
(6R)-1,6-dibenzylpiperidine-2,4-dione has a molecular weight of 293.37 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-1,6-dibenzylpiperidine-2,4-dione is sourced from PubChem (CID 54253000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).