C27H26N2O3 — CID 122600546
(6S)-4-(4-acetylbenzoyl)-1,6-dibenzylpiperazin-2-one (PubChem CID 122600546) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is (6S)-4-(4-acetylbenzoyl)-1,6-dibenzylpiperazin-2-one.
| Compound Name | (6S)-4-(4-acetylbenzoyl)-1,6-dibenzylpiperazin-2-one |
|---|---|
| PubChem CID | 122600546 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (6S)-4-(4-acetylbenzoyl)-1,6-dibenzylpiperazin-2-one |
| SMILES | CC(=O)c1ccc(C(=O)N2CC(=O)N(Cc3ccccc3)[C@@H](Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-20(30)23-12-14-24(15-13-23)27(32)28-18-25(16-21-8-4-2-5-9-21)29(26(31)19-28)17-22-10-6-3-7-11-22/h2-15,25H,16-19H2,1H3/t25-/m0/s1 |
| InChIKey | PBNFQBJBBMTSIA-VWLOTQADSA-N |
| XLogP | 3.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |