C27H27ClN2O4 — CID 122601030
(6S)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-(4-methoxybenzoyl)-6-(2-phenylethyl)piperazin-2-one (PubChem CID 122601030) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is (6S)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-(4-methoxybenzoyl)-6-(2-phenylethyl)piperazin-2-one.
| Compound Name | (6S)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-(4-methoxybenzoyl)-6-(2-phenylethyl)piperazin-2-one |
|---|---|
| PubChem CID | 122601030 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (6S)-1-[(5-chloro-2-hydroxyphenyl)methyl]-4-(4-methoxybenzoyl)-6-(2-phenylethyl)piperazin-2-one |
| SMILES | COc1ccc(C(=O)N2CC(=O)N(Cc3cc(Cl)ccc3O)[C@@H](CCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C27H27ClN2O4/c1-34-24-12-8-20(9-13-24)27(33)29-17-23(11-7-19-5-3-2-4-6-19)30(26(32)18-29)16-21-15-22(28)10-14-25(21)31/h2-6,8-10,12-15,23,31H,7,11,16-18H2,1H3/t23-/m0/s1 |
| InChIKey | RCTBUHKIGKKJKM-QHCPKHFHSA-N |
| XLogP | 4.54 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|