C24H28N2O3S — CID 145164186
(6S)-6-but-3-enyl-4-(4-methoxybenzoyl)-1-[(4-methylsulfanylphenyl)methyl]piperazin-2-one (PubChem CID 145164186) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is (6S)-6-but-3-enyl-4-(4-methoxybenzoyl)-1-[(4-methylsulfanylphenyl)methyl]piperazin-2-one.
| Compound Name | (6S)-6-but-3-enyl-4-(4-methoxybenzoyl)-1-[(4-methylsulfanylphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 145164186 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (6S)-6-but-3-enyl-4-(4-methoxybenzoyl)-1-[(4-methylsulfanylphenyl)methyl]piperazin-2-one |
| SMILES | C=CCC[C@H]1CN(C(=O)c2ccc(OC)cc2)CC(=O)N1Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C24H28N2O3S/c1-4-5-6-20-16-25(24(28)19-9-11-21(29-2)12-10-19)17-23(27)26(20)15-18-7-13-22(30-3)14-8-18/h4,7-14,20H,1,5-6,15-17H2,2-3H3/t20-/m0/s1 |
| InChIKey | RETCUFAGLJFFIA-FQEVSTJZSA-N |
| XLogP | 4.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|