C19H21NO2 — CID 134951863
1-[4-[(3R,4S)-1-benzyl-4-hydroxypyrrolidin-3-yl]phenyl]ethanone (PubChem CID 134951863) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[4-[(3R,4S)-1-benzyl-4-hydroxypyrrolidin-3-yl]phenyl]ethanone.
| Compound Name | 1-[4-[(3R,4S)-1-benzyl-4-hydroxypyrrolidin-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 134951863 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-[4-[(3R,4S)-1-benzyl-4-hydroxypyrrolidin-3-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc([C@@H]2CN(Cc3ccccc3)C[C@H]2O)cc1 |
| InChI | InChI=1S/C19H21NO2/c1-14(21)16-7-9-17(10-8-16)18-12-20(13-19(18)22)11-15-5-3-2-4-6-15/h2-10,18-19,22H,11-13H2,1H3/t18-,19+/m0/s1 |
| InChIKey | QPCWWGQBKAXVRT-RBUKOAKNSA-N |
| XLogP | 2.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |