C35H38N4O — CID 102127410
1,3-bis[(3R,4S)-1-benzyl-4-phenylpyrrolidin-3-yl]urea (PubChem CID 102127410) has the molecular formula C35H38N4O and a molecular weight of 530.72 g/mol. Its IUPAC name is 1,3-bis[(3R,4S)-1-benzyl-4-phenylpyrrolidin-3-yl]urea.
| Compound Name | 1,3-bis[(3R,4S)-1-benzyl-4-phenylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 102127410 |
| Molecular Formula | C35H38N4O |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 1,3-bis[(3R,4S)-1-benzyl-4-phenylpyrrolidin-3-yl]urea |
| SMILES | O=C(N[C@H]1CN(Cc2ccccc2)C[C@@H]1c1ccccc1)N[C@H]1CN(Cc2ccccc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C35H38N4O/c40-35(36-33-25-38(21-27-13-5-1-6-14-27)23-31(33)29-17-9-3-10-18-29)37-34-26-39(22-28-15-7-2-8-16-28)24-32(34)30-19-11-4-12-20-30/h1-20,31-34H,21-26H2,(H2,36,37,40)/t31-,32-,33+,34+/m1/s1 |
| InChIKey | JEHIMIMPLFNJHG-WZJLIZBTSA-N |
| XLogP | 5.62 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |