C24H27ClN2 — CID 73350587
(3S,4R)-N,1-dibenzyl-4-phenylpyrrolidin-3-amine;hydrochloride (PubChem CID 73350587) has the molecular formula C24H27ClN2 and a molecular weight of 378.95 g/mol. Its IUPAC name is (3S,4R)-N,1-dibenzyl-4-phenylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S,4R)-N,1-dibenzyl-4-phenylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 73350587 |
| Molecular Formula | C24H27ClN2 |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (3S,4R)-N,1-dibenzyl-4-phenylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.c1ccc(CN[C@@H]2CN(Cc3ccccc3)C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2.ClH/c1-4-10-20(11-5-1)16-25-24-19-26(17-21-12-6-2-7-13-21)18-23(24)22-14-8-3-9-15-22;/h1-15,23-25H,16-19H2;1H/t23-,24+;/m0./s1 |
| InChIKey | CXKROPGWLZLXCH-KZDWWKKTSA-N |
| XLogP | 4.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |