C25H27ClN2 — CID 7441557
(3R,4R)-1-benzyl-N-[(2-chlorophenyl)methyl]-3-phenylpiperidin-4-amine (PubChem CID 7441557) has the molecular formula C25H27ClN2 and a molecular weight of 390.96 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-N-[(2-chlorophenyl)methyl]-3-phenylpiperidin-4-amine.
| Compound Name | (3R,4R)-1-benzyl-N-[(2-chlorophenyl)methyl]-3-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 7441557 |
| Molecular Formula | C25H27ClN2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (3R,4R)-1-benzyl-N-[(2-chlorophenyl)methyl]-3-phenylpiperidin-4-amine |
| SMILES | Clc1ccccc1CN[C@@H]1CCN(Cc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H27ClN2/c26-24-14-8-7-13-22(24)17-27-25-15-16-28(18-20-9-3-1-4-10-20)19-23(25)21-11-5-2-6-12-21/h1-14,23,25,27H,15-19H2/t23-,25+/m0/s1 |
| InChIKey | JONOYXATECIXQY-UKILVPOCSA-N |
| XLogP | 5.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |