C23H26N2O — CID 124813938
(3S,4S)-1-benzyl-N-(furan-2-ylmethyl)-3-phenylpiperidin-4-amine (PubChem CID 124813938) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-N-(furan-2-ylmethyl)-3-phenylpiperidin-4-amine.
| Compound Name | (3S,4S)-1-benzyl-N-(furan-2-ylmethyl)-3-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 124813938 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3S,4S)-1-benzyl-N-(furan-2-ylmethyl)-3-phenylpiperidin-4-amine |
| SMILES | c1ccc(CN2CC[C@H](NCc3ccco3)[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H26N2O/c1-3-8-19(9-4-1)17-25-14-13-23(24-16-21-12-7-15-26-21)22(18-25)20-10-5-2-6-11-20/h1-12,15,22-24H,13-14,16-18H2/t22-,23+/m1/s1 |
| InChIKey | FCRZKCYWZIJWKU-PKTZIBPZSA-N |
| XLogP | 4.43 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |