C25H28N2 — CID 7450726
(3R,4R)-N,1-dibenzyl-3-phenylpiperidin-4-amine (PubChem CID 7450726) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (3R,4R)-N,1-dibenzyl-3-phenylpiperidin-4-amine.
| Compound Name | (3R,4R)-N,1-dibenzyl-3-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 7450726 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | (3R,4R)-N,1-dibenzyl-3-phenylpiperidin-4-amine |
| SMILES | c1ccc(CN[C@@H]2CCN(Cc3ccccc3)C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2/c1-4-10-21(11-5-1)18-26-25-16-17-27(19-22-12-6-2-7-13-22)20-24(25)23-14-8-3-9-15-23/h1-15,24-26H,16-20H2/t24-,25+/m0/s1 |
| InChIKey | MGXJQLLOZXQAEP-LOSJGSFVSA-N |
| XLogP | 4.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |