C26H28N2O2 — CID 124909525
(3S,4S)-N-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-phenylpiperidin-4-amine (PubChem CID 124909525) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (3S,4S)-N-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-phenylpiperidin-4-amine.
| Compound Name | (3S,4S)-N-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 124909525 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (3S,4S)-N-(1,3-benzodioxol-5-ylmethyl)-1-benzyl-3-phenylpiperidin-4-amine |
| SMILES | c1ccc(CN2CC[C@H](NCc3ccc4c(c3)OCO4)[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-3-7-20(8-4-1)17-28-14-13-24(23(18-28)22-9-5-2-6-10-22)27-16-21-11-12-25-26(15-21)30-19-29-25/h1-12,15,23-24,27H,13-14,16-19H2/t23-,24+/m1/s1 |
| InChIKey | KXBHLDGIMNJBAC-RPWUZVMVSA-N |
| XLogP | 4.56 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |