C19H22N2O2 — CID 57162412
(2S,3S)-N-(1,3-benzodioxol-5-ylmethyl)-2-phenylpiperidin-3-amine (PubChem CID 57162412) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2S,3S)-N-(1,3-benzodioxol-5-ylmethyl)-2-phenylpiperidin-3-amine.
| Compound Name | (2S,3S)-N-(1,3-benzodioxol-5-ylmethyl)-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 57162412 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2S,3S)-N-(1,3-benzodioxol-5-ylmethyl)-2-phenylpiperidin-3-amine |
| SMILES | c1ccc([C@@H]2NCCC[C@@H]2NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-2-5-15(6-3-1)19-16(7-4-10-20-19)21-12-14-8-9-17-18(11-14)23-13-22-17/h1-3,5-6,8-9,11,16,19-21H,4,7,10,12-13H2/t16-,19-/m0/s1 |
| InChIKey | FZDSPJYARSDGDR-LPHOPBHVSA-N |
| XLogP | 3.00 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |