C20H22N2O2 — CID 70993058
N-(1,3-benzodioxol-5-ylmethyl)-2,3,4,4a,9,9a-hexahydro-1H-carbazol-1-amine (PubChem CID 70993058) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,3,4,4a,9,9a-hexahydro-1H-carbazol-1-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,3,4,4a,9,9a-hexahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 70993058 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,3,4,4a,9,9a-hexahydro-1H-carbazol-1-amine |
| SMILES | c1ccc2c(c1)NC1C(NCc3ccc4c(c3)OCO4)CCCC21 |
| InChI | InChI=1S/C20H22N2O2/c1-2-6-16-14(4-1)15-5-3-7-17(20(15)22-16)21-11-13-8-9-18-19(10-13)24-12-23-18/h1-2,4,6,8-10,15,17,20-22H,3,5,7,11-12H2 |
| InChIKey | LEIOZPUNRFEFMS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |