C17H20N2 — CID 11499795
(2S,3R)-N-benzyl-2-phenylpyrrolidin-3-amine (PubChem CID 11499795) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (2S,3R)-N-benzyl-2-phenylpyrrolidin-3-amine.
| Compound Name | (2S,3R)-N-benzyl-2-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 11499795 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2S,3R)-N-benzyl-2-phenylpyrrolidin-3-amine |
| SMILES | c1ccc(CN[C@@H]2CCN[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-3-7-14(8-4-1)13-19-16-11-12-18-17(16)15-9-5-2-6-10-15/h1-10,16-19H,11-13H2/t16-,17+/m1/s1 |
| InChIKey | NBGVIYMKELGYKN-SJORKVTESA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |