C19H21F3N2 — CID 67819925
(2S,3S)-2-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-amine (PubChem CID 67819925) has the molecular formula C19H21F3N2 and a molecular weight of 334.39 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-amine.
| Compound Name | (2S,3S)-2-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 67819925 |
| Molecular Formula | C19H21F3N2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2S,3S)-2-phenyl-N-[[3-(trifluoromethyl)phenyl]methyl]piperidin-3-amine |
| SMILES | FC(F)(F)c1cccc(CN[C@H]2CCCN[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C19H21F3N2/c20-19(21,22)16-9-4-6-14(12-16)13-24-17-10-5-11-23-18(17)15-7-2-1-3-8-15/h1-4,6-9,12,17-18,23-24H,5,10-11,13H2/t17-,18-/m0/s1 |
| InChIKey | YEYCUPFNUKEJFG-ROUUACIJSA-N |
| XLogP | 4.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |