C18H22N2O — CID 69248691
(2R,3S)-N-[(2-methoxyphenyl)methyl]-2-phenylpyrrolidin-3-amine (PubChem CID 69248691) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (2R,3S)-N-[(2-methoxyphenyl)methyl]-2-phenylpyrrolidin-3-amine.
| Compound Name | (2R,3S)-N-[(2-methoxyphenyl)methyl]-2-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 69248691 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (2R,3S)-N-[(2-methoxyphenyl)methyl]-2-phenylpyrrolidin-3-amine |
| SMILES | COc1ccccc1CN[C@H]1CCN[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H22N2O/c1-21-17-10-6-5-9-15(17)13-20-16-11-12-19-18(16)14-7-3-2-4-8-14/h2-10,16,18-20H,11-13H2,1H3/t16-,18+/m0/s1 |
| InChIKey | QWVZERSEHNWXGU-FUHWJXTLSA-N |
| XLogP | 2.89 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |