C20H26N2O — CID 54131867
(2R,3R)-N-[(2-ethoxyphenyl)methyl]-2-phenylpiperidin-3-amine (PubChem CID 54131867) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (2R,3R)-N-[(2-ethoxyphenyl)methyl]-2-phenylpiperidin-3-amine.
| Compound Name | (2R,3R)-N-[(2-ethoxyphenyl)methyl]-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 54131867 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (2R,3R)-N-[(2-ethoxyphenyl)methyl]-2-phenylpiperidin-3-amine |
| SMILES | CCOc1ccccc1CN[C@@H]1CCCN[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-2-23-19-13-7-6-11-17(19)15-22-18-12-8-14-21-20(18)16-9-4-3-5-10-16/h3-7,9-11,13,18,20-22H,2,8,12,14-15H2,1H3/t18-,20-/m1/s1 |
| InChIKey | NUYAJAMOEASYOH-UYAOXDASSA-N |
| XLogP | 3.67 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |