C19H23FN2O — CID 54152550
(2R,3R)-2-(3-fluorophenyl)-N-[(2-methoxyphenyl)methyl]piperidin-3-amine (PubChem CID 54152550) has the molecular formula C19H23FN2O and a molecular weight of 314.40 g/mol. Its IUPAC name is (2R,3R)-2-(3-fluorophenyl)-N-[(2-methoxyphenyl)methyl]piperidin-3-amine.
| Compound Name | (2R,3R)-2-(3-fluorophenyl)-N-[(2-methoxyphenyl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 54152550 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | (2R,3R)-2-(3-fluorophenyl)-N-[(2-methoxyphenyl)methyl]piperidin-3-amine |
| SMILES | COc1ccccc1CN[C@@H]1CCCN[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN2O/c1-23-18-10-3-2-6-15(18)13-22-17-9-5-11-21-19(17)14-7-4-8-16(20)12-14/h2-4,6-8,10,12,17,19,21-22H,5,9,11,13H2,1H3/t17-,19-/m1/s1 |
| InChIKey | OITAYVQJRGMBHS-IEBWSBKVSA-N |
| XLogP | 3.42 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |