C19H24Cl4N2O — CID 18533782
N-[(5-chloro-2-methoxyphenyl)methyl]-2-(3-chlorophenyl)piperidin-3-amine;dihydrochloride (PubChem CID 18533782) has the molecular formula C19H24Cl4N2O and a molecular weight of 438.23 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-2-(3-chlorophenyl)piperidin-3-amine;dihydrochloride.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-(3-chlorophenyl)piperidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 18533782 |
| Molecular Formula | C19H24Cl4N2O |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-(3-chlorophenyl)piperidin-3-amine;dihydrochloride |
| SMILES | COc1ccc(Cl)cc1CNC1CCCNC1c1cccc(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C19H22Cl2N2O.2ClH/c1-24-18-8-7-16(21)11-14(18)12-23-17-6-3-9-22-19(17)13-4-2-5-15(20)10-13;;/h2,4-5,7-8,10-11,17,19,22-23H,3,6,9,12H2,1H3;2*1H |
| InChIKey | LXKZMORUZBLOFG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |