C19H25Cl2FN2S — CID 19696673
N-[(5-fluoro-2-methylsulfanylphenyl)methyl]-2-phenylpiperidin-3-amine;dihydrochloride (PubChem CID 19696673) has the molecular formula C19H25Cl2FN2S and a molecular weight of 403.39 g/mol. Its IUPAC name is N-[(5-fluoro-2-methylsulfanylphenyl)methyl]-2-phenylpiperidin-3-amine;dihydrochloride.
| Compound Name | N-[(5-fluoro-2-methylsulfanylphenyl)methyl]-2-phenylpiperidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 19696673 |
| Molecular Formula | C19H25Cl2FN2S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[(5-fluoro-2-methylsulfanylphenyl)methyl]-2-phenylpiperidin-3-amine;dihydrochloride |
| SMILES | CSc1ccc(F)cc1CNC1CCCNC1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H23FN2S.2ClH/c1-23-18-10-9-16(20)12-15(18)13-22-17-8-5-11-21-19(17)14-6-3-2-4-7-14;;/h2-4,6-7,9-10,12,17,19,21-22H,5,8,11,13H2,1H3;2*1H |
| InChIKey | DOYXBZRVJNIJFJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |