C20H27N3 — CID 57158531
(2S,3S)-N-[[2-(ethylamino)phenyl]methyl]-2-phenylpiperidin-3-amine (PubChem CID 57158531) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is (2S,3S)-N-[[2-(ethylamino)phenyl]methyl]-2-phenylpiperidin-3-amine.
| Compound Name | (2S,3S)-N-[[2-(ethylamino)phenyl]methyl]-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 57158531 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | (2S,3S)-N-[[2-(ethylamino)phenyl]methyl]-2-phenylpiperidin-3-amine |
| SMILES | CCNc1ccccc1CN[C@H]1CCCN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H27N3/c1-2-21-18-12-7-6-11-17(18)15-23-19-13-8-14-22-20(19)16-9-4-3-5-10-16/h3-7,9-12,19-23H,2,8,13-15H2,1H3/t19-,20-/m0/s1 |
| InChIKey | JXTYRCJTYYVXRL-PMACEKPBSA-N |
| XLogP | 3.70 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |