C21H24ClN3 — CID 67619110
(2S,3S)-2-phenyl-N-(quinolin-8-ylmethyl)piperidin-3-amine;hydrochloride (PubChem CID 67619110) has the molecular formula C21H24ClN3 and a molecular weight of 353.90 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-N-(quinolin-8-ylmethyl)piperidin-3-amine;hydrochloride.
| Compound Name | (2S,3S)-2-phenyl-N-(quinolin-8-ylmethyl)piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 67619110 |
| Molecular Formula | C21H24ClN3 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (2S,3S)-2-phenyl-N-(quinolin-8-ylmethyl)piperidin-3-amine;hydrochloride |
| SMILES | Cl.c1ccc([C@@H]2NCCC[C@@H]2NCc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C21H23N3.ClH/c1-2-7-17(8-3-1)21-19(12-6-14-23-21)24-15-18-10-4-9-16-11-5-13-22-20(16)18;/h1-5,7-11,13,19,21,23-24H,6,12,14-15H2;1H/t19-,21-;/m0./s1 |
| InChIKey | NIVMGIFILNTLME-RQBPZYBGSA-N |
| XLogP | 4.24 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |