C17H18Cl2N2 — CID 11659767
(2S,3S)-N-[(2,3-dichlorophenyl)methyl]-2-phenylpyrrolidin-3-amine (PubChem CID 11659767) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is (2S,3S)-N-[(2,3-dichlorophenyl)methyl]-2-phenylpyrrolidin-3-amine.
| Compound Name | (2S,3S)-N-[(2,3-dichlorophenyl)methyl]-2-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 11659767 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (2S,3S)-N-[(2,3-dichlorophenyl)methyl]-2-phenylpyrrolidin-3-amine |
| SMILES | Clc1cccc(CN[C@H]2CCN[C@H]2c2ccccc2)c1Cl |
| InChI | InChI=1S/C17H18Cl2N2/c18-14-8-4-7-13(16(14)19)11-21-15-9-10-20-17(15)12-5-2-1-3-6-12/h1-8,15,17,20-21H,9-11H2/t15-,17-/m0/s1 |
| InChIKey | AMNWGSGTKLDTSY-RDJZCZTQSA-N |
| XLogP | 4.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |