C25H28N2O — CID 69249147
(2R,3R)-N-[[3-(4-ethylphenoxy)phenyl]methyl]-2-phenylpyrrolidin-3-amine (PubChem CID 69249147) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is (2R,3R)-N-[[3-(4-ethylphenoxy)phenyl]methyl]-2-phenylpyrrolidin-3-amine.
| Compound Name | (2R,3R)-N-[[3-(4-ethylphenoxy)phenyl]methyl]-2-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 69249147 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (2R,3R)-N-[[3-(4-ethylphenoxy)phenyl]methyl]-2-phenylpyrrolidin-3-amine |
| SMILES | CCc1ccc(Oc2cccc(CN[C@@H]3CCN[C@@H]3c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H28N2O/c1-2-19-11-13-22(14-12-19)28-23-10-6-7-20(17-23)18-27-24-15-16-26-25(24)21-8-4-3-5-9-21/h3-14,17,24-27H,2,15-16,18H2,1H3/t24-,25-/m1/s1 |
| InChIKey | WWRUURDZCUGKNH-JWQCQUIFSA-N |
| XLogP | 5.23 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |