C19H23NO6 — CID 102478590
(1S,2R,4S,5R)-6-[(3-phenoxyphenyl)methylamino]cyclohexane-1,2,3,4,5-pentol (PubChem CID 102478590) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (1S,2R,4S,5R)-6-[(3-phenoxyphenyl)methylamino]cyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2R,4S,5R)-6-[(3-phenoxyphenyl)methylamino]cyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 102478590 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (1S,2R,4S,5R)-6-[(3-phenoxyphenyl)methylamino]cyclohexane-1,2,3,4,5-pentol |
| SMILES | OC1[C@@H](O)[C@H](O)C(NCc2cccc(Oc3ccccc3)c2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H23NO6/c21-15-14(16(22)18(24)19(25)17(15)23)20-10-11-5-4-8-13(9-11)26-12-6-2-1-3-7-12/h1-9,14-25H,10H2/t14?,15-,16+,17+,18-,19? |
| InChIKey | CIIYVJRIKUNNRA-JQGYHEGWSA-N |
| XLogP | -0.24 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |