C22H21NO2 — CID 52806530
(1R,2S)-1-[(3-phenoxyphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 52806530) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (1R,2S)-1-[(3-phenoxyphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2S)-1-[(3-phenoxyphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 52806530 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (1R,2S)-1-[(3-phenoxyphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@H]1Cc2ccccc2[C@H]1NCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H21NO2/c24-21-14-17-8-4-5-12-20(17)22(21)23-15-16-7-6-11-19(13-16)25-18-9-2-1-3-10-18/h1-13,21-24H,14-15H2/t21-,22+/m0/s1 |
| InChIKey | NHWMSDMBUKUPGG-FCHUYYIVSA-N |
| XLogP | 4.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |