C25H37Cl2N3 — CID 175654335
1-benzyl-3-phenyl-N-(2-piperidin-1-ylethyl)piperidin-4-amine;dihydrochloride (PubChem CID 175654335) has the molecular formula C25H37Cl2N3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 1-benzyl-3-phenyl-N-(2-piperidin-1-ylethyl)piperidin-4-amine;dihydrochloride.
| Compound Name | 1-benzyl-3-phenyl-N-(2-piperidin-1-ylethyl)piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 175654335 |
| Molecular Formula | C25H37Cl2N3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 1-benzyl-3-phenyl-N-(2-piperidin-1-ylethyl)piperidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CN2CCC(NCCN3CCCCC3)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H35N3.2ClH/c1-4-10-22(11-5-1)20-28-18-14-25(24(21-28)23-12-6-2-7-13-23)26-15-19-27-16-8-3-9-17-27;;/h1-2,4-7,10-13,24-26H,3,8-9,14-21H2;2*1H |
| InChIKey | YCIHFBYJYSZLCU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |