C23H23N3O — CID 100745479
N-[(3S,4R)-1-benzyl-4-phenylpyrrolidin-3-yl]pyridine-3-carboxamide (PubChem CID 100745479) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[(3S,4R)-1-benzyl-4-phenylpyrrolidin-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[(3S,4R)-1-benzyl-4-phenylpyrrolidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 100745479 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[(3S,4R)-1-benzyl-4-phenylpyrrolidin-3-yl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CN(Cc2ccccc2)C[C@H]1c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C23H23N3O/c27-23(20-12-7-13-24-14-20)25-22-17-26(15-18-8-3-1-4-9-18)16-21(22)19-10-5-2-6-11-19/h1-14,21-22H,15-17H2,(H,25,27)/t21-,22+/m0/s1 |
| InChIKey | LYCCOGLCDWEFCR-FCHUYYIVSA-N |
| XLogP | 3.48 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |