C18H19ClN2O — CID 101077011
N-[(3S,4S)-1-benzyl-4-chloropyrrolidin-3-yl]benzamide (PubChem CID 101077011) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is N-[(3S,4S)-1-benzyl-4-chloropyrrolidin-3-yl]benzamide.
| Compound Name | N-[(3S,4S)-1-benzyl-4-chloropyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 101077011 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[(3S,4S)-1-benzyl-4-chloropyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CN(Cc2ccccc2)C[C@@H]1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN2O/c19-16-12-21(11-14-7-3-1-4-8-14)13-17(16)20-18(22)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H,20,22)/t16-,17-/m0/s1 |
| InChIKey | LVZNGIFGIHDHKF-IRXDYDNUSA-N |
| XLogP | 2.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|