C21H26N2O2 — CID 110202536
N-[(3S,4R)-4-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl]benzamide (PubChem CID 110202536) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[(3S,4R)-4-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl]benzamide.
| Compound Name | N-[(3S,4R)-4-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 110202536 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[(3S,4R)-4-(hydroxymethyl)-1-(3-phenylpropyl)pyrrolidin-3-yl]benzamide |
| SMILES | O=C(N[C@@H]1CN(CCCc2ccccc2)C[C@H]1CO)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c24-16-19-14-23(13-7-10-17-8-3-1-4-9-17)15-20(19)22-21(25)18-11-5-2-6-12-18/h1-6,8-9,11-12,19-20,24H,7,10,13-16H2,(H,22,25)/t19-,20+/m0/s1 |
| InChIKey | YRGFYDKELBLBRF-VQTJNVASSA-N |
| XLogP | 2.34 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |