C27H30N2O3 — CID 10836395
N-[(3S,4S)-1-benzyl-4-hydroxyazepan-3-yl]-4-phenylmethoxybenzamide (PubChem CID 10836395) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[(3S,4S)-1-benzyl-4-hydroxyazepan-3-yl]-4-phenylmethoxybenzamide.
| Compound Name | N-[(3S,4S)-1-benzyl-4-hydroxyazepan-3-yl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 10836395 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[(3S,4S)-1-benzyl-4-hydroxyazepan-3-yl]-4-phenylmethoxybenzamide |
| SMILES | O=C(N[C@H]1CN(Cc2ccccc2)CCC[C@@H]1O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N2O3/c30-26-12-7-17-29(18-21-8-3-1-4-9-21)19-25(26)28-27(31)23-13-15-24(16-14-23)32-20-22-10-5-2-6-11-22/h1-6,8-11,13-16,25-26,30H,7,12,17-20H2,(H,28,31)/t25-,26-/m0/s1 |
| InChIKey | UTAMDSHXFLNCGA-UIOOFZCWSA-N |
| XLogP | 4.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |