C27H29FN2O3 — CID 74418879
N-(1-benzyl-4-hydroxyazepan-3-yl)-4-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 74418879) has the molecular formula C27H29FN2O3 and a molecular weight of 448.54 g/mol. Its IUPAC name is N-(1-benzyl-4-hydroxyazepan-3-yl)-4-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-(1-benzyl-4-hydroxyazepan-3-yl)-4-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 74418879 |
| Molecular Formula | C27H29FN2O3 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | N-(1-benzyl-4-hydroxyazepan-3-yl)-4-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | O=C(NC1CN(Cc2ccccc2)CCCC1O)c1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H29FN2O3/c28-23-12-8-21(9-13-23)19-33-24-14-10-22(11-15-24)27(32)29-25-18-30(16-4-7-26(25)31)17-20-5-2-1-3-6-20/h1-3,5-6,8-15,25-26,31H,4,7,16-19H2,(H,29,32) |
| InChIKey | PFVOIXGYBIMQIU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |