C23H29N3O5 — CID 74505286
4-(2-amino-2-oxoethoxy)-N-[4-hydroxy-1-[(3-methoxyphenyl)methyl]azepan-3-yl]benzamide (PubChem CID 74505286) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[4-hydroxy-1-[(3-methoxyphenyl)methyl]azepan-3-yl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[4-hydroxy-1-[(3-methoxyphenyl)methyl]azepan-3-yl]benzamide |
|---|---|
| PubChem CID | 74505286 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[4-hydroxy-1-[(3-methoxyphenyl)methyl]azepan-3-yl]benzamide |
| SMILES | COc1cccc(CN2CCCC(O)C(NC(=O)c3ccc(OCC(N)=O)cc3)C2)c1 |
| InChI | InChI=1S/C23H29N3O5/c1-30-19-5-2-4-16(12-19)13-26-11-3-6-21(27)20(14-26)25-23(29)17-7-9-18(10-8-17)31-15-22(24)28/h2,4-5,7-10,12,20-21,27H,3,6,11,13-15H2,1H3,(H2,24,28)(H,25,29) |
| InChIKey | QYHFRFUCVNHJLK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |