C24H30N2O6 — CID 26742263
4-[[(3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]azepan-1-yl]methyl]benzoic acid (PubChem CID 26742263) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is 4-[[(3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]azepan-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]azepan-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 26742263 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-[[(3R,4R)-4-hydroxy-3-[[4-(2-methoxyethoxy)benzoyl]amino]azepan-1-yl]methyl]benzoic acid |
| SMILES | COCCOc1ccc(C(=O)N[C@@H]2CN(Cc3ccc(C(=O)O)cc3)CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C24H30N2O6/c1-31-13-14-32-20-10-8-18(9-11-20)23(28)25-21-16-26(12-2-3-22(21)27)15-17-4-6-19(7-5-17)24(29)30/h4-11,21-22,27H,2-3,12-16H2,1H3,(H,25,28)(H,29,30)/t21-,22-/m1/s1 |
| InChIKey | VLSKUVITVGRLCT-FGZHOGPDSA-N |
| XLogP | 2.17 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|